This compound is the hydrochloride salt of N-(fluorenylmethoxycarbonyl)-L-lysine benzyl ester, a protected amino acid derivative commonly used in peptide synthesis. It features an Fmoc protecting group on the amino terminus and a benzyl ester on the carboxyl terminus, enabling selective deprotection during solid-phase peptide assembly.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 159551-46-9
Fmoc-D-Lys-OH.HCl
Fmoc-protected amino acid intermediate
Fmoc-L-lysine
Protected amino acid for peptide synthesis
(2S)-6-amino-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)hexanoic acid hydrochloride
Fmoc-protected lysine for peptide synthesis
N-((Phenylmethoxy)carbonyl)-L-tyrosine methyl ester
Peptide synthesis protected amino acid
N-(Benzoxycarbonyl)-O-(tert-butyl)-L-serine
Peptide synthesis protected amino acid
(R)-(((Phenylmethoxy)carbonyl)amino)phenylacetic acid
Peptide synthesis protected amino acid
(2S)-2-(9H-Fuoren-9-ylmethoxycarbonylamino)-6-((1-(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)-3-methylbutylidene)amino)hexanoic acid
Peptide synthesis protected amino acid
(2S)-6-azido-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)hexanoic acid
Fmoc-protected amino acid building block
benzyl (2S)-6-amino-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoate;hydrochloride
YMCYNJUCGZDWCK-SNYZSRNZSA-N
C1=CC=C(C=C1)COC(=O)[C@H](CCCCN)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24.Cl