This compound is a protected amino acid derivative featuring a fluorenylmethoxycarbonyl (Fmoc) protecting group and a side-chain modification with a hydroxy-dimethylcyclohexenone moiety. It is primarily used as a building block in solid-phase peptide synthesis.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 204777-78-6
FMOC-DAB(IVDDE)-OH
protected amino acid building block
Fmoc-D-Lys(Dde)-OH
protected amino acid for peptide synthesis
Fmoc-Lys(Dde)-OH
Protected amino acid for peptide synthesis
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-[1-(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)ethylideneamino]butanoic acid
peptide synthesis intermediate
N-(Benzoxycarbonyl)-O-(tert-butyl)-L-serine
Peptide synthesis protected amino acid
N-((Phenylmethoxy)carbonyl)-L-tyrosine methyl ester
Peptide synthesis protected amino acid
Benzyl (2S)-6-amino-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoate;hydrochloride
Peptide synthesis protected amino acid
(R)-(((Phenylmethoxy)carbonyl)amino)phenylacetic acid
Peptide synthesis protected amino acid
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[[1-(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)-3-methylbutylidene]amino]hexanoic acid
LHJJUCZESVFWSO-MHZLTWQESA-N
CC(C)CC(=NCCCC[C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13)C4=C(CC(CC4=O)(C)C)O