N-Carbobenzoxy-D-phenylglycine (Cbz-D-Phg-OH) is a protected amino acid derivative used in peptide synthesis. Its structure features a benzyloxycarbonyl (Cbz) protecting group on the amino group, enabling selective incorporation of D-phenylglycine into peptide chains.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 17609-52-8
(2S)-2-(9H-Fuoren-9-ylmethoxycarbonylamino)-6-((1-(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)-3-methylbutylidene)amino)hexanoic acid
Peptide synthesis protected amino acid
N-((Phenylmethoxy)carbonyl)-L-tyrosine methyl ester
Peptide synthesis protected amino acid
Benzyl (2S)-6-amino-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoate;hydrochloride
Peptide synthesis protected amino acid
N-(Benzoxycarbonyl)-O-(tert-butyl)-L-serine
Peptide synthesis protected amino acid
5-Bromosalicylaldehyde
Pharmaceutical intermediate
3-hydrazinylbenzonitrile
Pharmaceutical intermediate
Amisulpride EP impurity C
Pharmaceutical impurity reference standard
3-(2-Bromoacetyl)pyridine hydrobromide
pharmaceutical intermediate
(2R)-2-phenyl-2-(phenylmethoxycarbonylamino)acetic acid
RLDJWBVOZVJJOS-CQSZACIVSA-N
C1=CC=C(C=C1)COC(=O)N[C@H](C2=CC=CC=C2)C(=O)O