This compound is a protected amino acid derivative used in peptide synthesis. It features a benzyloxycarbonyl (Cbz) protecting group on the amino group and a tert-butyl group on the serine side chain, making it suitable for stepwise assembly of peptides in laboratory and manufacturing settings.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 1676-75-1
(2S)-2-(9H-Fuoren-9-ylmethoxycarbonylamino)-6-((1-(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)-3-methylbutylidene)amino)hexanoic acid
Peptide synthesis protected amino acid
(R)-(((Phenylmethoxy)carbonyl)amino)phenylacetic acid
Peptide synthesis protected amino acid
N-((Phenylmethoxy)carbonyl)-L-tyrosine methyl ester
Peptide synthesis protected amino acid
Benzyl (2S)-6-amino-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoate;hydrochloride
Peptide synthesis protected amino acid
Boc-Asp(OtBu)-OH
protected amino acid for peptide synthesis
Fmoc-Thr(tBu)-Thr(Psi(Me,Me)pro)-OH
Protected amino acid building block
1-(3-methoxypropyl)piperidin-4-one
pharmaceutical intermediate
1-(benzothiophen-4-yl)piperazine;dihydrochloride
pharmaceutical intermediate
3-[(2-methylpropan-2-yl)oxy]-2-(phenylmethoxycarbonylamino)propanoic acid
TXDGEONUWGOCJG-UHFFFAOYSA-N
CC(C)(C)OCC(C(=O)O)NC(=O)OCC1=CC=CC=C1