This compound is an Fmoc-protected amino acid derivative featuring an azide group on the side chain. It is primarily used as a building block in solid-phase peptide synthesis, enabling the introduction of azide functionality for click chemistry applications.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 159610-89-6
Fmoc-4-(tert-butoxycarbonylmethoxy)-L-phenylalanine
Fmoc-protected amino acid building block
(S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(6-methoxypyridin-3-yl)propanoic acid
Fmoc-protected amino acid building block
(S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(4-methoxy-2-methylphenyl)propanoic acid
Fmoc-protected amino acid building block
(S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-2-methyldec-9-enoic acid
Fmoc-protected amino acid building block
(1R,2S)-1-(((1,1-Dimethylethoxy)carbonyl)amino)-2-ethenylcyclopropanecarboxylic acid
Pharmaceutical intermediate
Pyronaridine Impurity 13
Impurity reference standard for pyronaridine
1-boc-4-methylenepiperidine
Pharmaceutical intermediate
1-[(tert-butoxy)carbonyl]azetidine-2-carboxylic acid
Pharmaceutical intermediate for peptide synthesis
(2S)-6-azido-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid
PJRFTUILPGJJIO-IBGZPJMESA-N
C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CCCCN=[N+]=[N-])C(=O)O