This compound is a cyclopropane-based pharmaceutical intermediate featuring a protected amino acid structure. Its significance lies in its use as a building block for the synthesis of more complex pharmaceutical compounds.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 159622-10-3
Pyronaridine Impurity 13
Impurity reference standard for pyronaridine
1-boc-4-methylenepiperidine
Pharmaceutical intermediate
1-[(tert-butoxy)carbonyl]azetidine-2-carboxylic acid
Pharmaceutical intermediate for peptide synthesis
Fmoc-Aad(otBu)-OH
Protected amino acid for peptide synthesis
trans-(1R,2S)-2-ethenyl-1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopropane-1-carboxylic acid
RFAQWADNTLIWMG-RDDDGLTNSA-N
CC(C)(C)OC(=O)N[C@@]1(C[C@H]1C=C)C(=O)O
—