Fmoc-Aad(otBu)-OH is a protected amino acid derivative used in solid-phase peptide synthesis. Its structure includes a fluorenylmethoxycarbonyl (Fmoc) protecting group and a tert-butyl ester on the side chain, enabling selective deprotection during peptide assembly.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 159751-47-0
Fmoc-L-Glu(OtBu)-OH monohydrate
protected amino acid for peptide synthesis
Fmoc-L-glutamic acid 5-tert-butyl ester
Protected amino acid for peptide synthesis
(2R)-5-(tert-butoxy)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-5-oxopentanoic acid
peptide synthesis intermediate
4-tert-Butyl N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-D-aspartate
Peptide synthesis intermediate
Diamminediiodoplatinum
platinum-based pharmaceutical intermediate
(E)-2-cyano-3-morpholinoacrylamide
Pharmaceutical intermediate
Fmoc-Lys(Mmt)-OH
Fmoc-protected amino acid intermediate
(2S)-5-((aminocarbonyl)amino)-2-(((2S)-2-amino-3-methylbutanoyl)amino)-N-(4-(hydroxymethyl)phenyl)pentanamide
antibody-drug conjugate linker intermediate
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[(2-methylpropan-2-yl)oxy]-6-oxohexanoic acid
FFLAQPKWVSSKJC-NRFANRHFSA-N
CC(C)(C)OC(=O)CCC[C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13