This compound is a chiral peptide derivative used as a linker intermediate in the production of antibody-drug conjugates (ADCs). Its structure includes amine, amide, and alcohol functional groups, contributing to its role in forming stable conjugates.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 159857-79-1
MC-Val-Cit-PAB-OH
Pharmaceutical intermediate for antibody-drug conjugates
(S)-2-((S)-2-((((9H-FLUOREN-9-YL)METHOXY)CARBONYL)AMINO)-3-METHYLBUTANAMIDO)-5-UREIDOPENTANOIC ACID
peptide synthesis intermediate
Dxd
exatecan derivative for antibody-drug conjugate
(R)-3-((tert-Butoxycarbonyl)amino)butanoic acid
Pharmaceutical intermediate for peptide synthesis
(2S)-2-[[(2S)-2-amino-3-methylbutanoyl]amino]-5-(carbamoylamino)-N-[4-(hydroxymethyl)phenyl]pentanamide
VEGGTWZUZGZKHY-GJZGRUSLSA-N
CC(C)[C@@H](C(=O)N[C@@H](CCCNC(=O)N)C(=O)NC1=CC=C(C=C1)CO)N