This compound is a hydrochloride salt of Fmoc-protected L-lysine, commonly used as a building block in solid-phase peptide synthesis. Its significance lies in the Fmoc (9-fluorenylmethoxycarbonyl) group, which temporarily protects the amino group during peptide chain assembly.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 139262-23-0
Fmoc-L-lysine
Protected amino acid for peptide synthesis
Benzyl (2S)-6-amino-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoate;hydrochloride
Peptide synthesis protected amino acid
(2S)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)hexanoic acid
Fmoc-protected amino acid for peptide synthesis
Aceclofenac Methyl Ester
Pharmaceutical intermediate for aceclofenac synthesis
Aceclofenac Ethyl Ester
Pharmaceutical intermediate for aceclofenac production
Aceclofenac Tert-Butyl Ester
Pharmaceutical intermediate for aceclofenac synthesis
Tert-butyl 4-(methoxy(methyl)carbamoyl)piperidine-1-carboxylate
Pharmaceutical intermediate
Fmoc-D-Lys-OH.HCl
Fmoc-protected amino acid intermediate
(2S)-6-amino-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid;hydrochloride
MVMZFAIUUXYFGY-FYZYNONXSA-N
C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CCCCN)C(=O)O.Cl