This compound is a fully deuterated form of octane, where all eighteen hydrogen atoms are replaced by deuterium. It is primarily used as a solvent and internal standard in NMR spectroscopy.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
(2H18)Octane 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
N-decane-d22
deuterated alkane reference standard
N-DODECANE-D26
deuterated standard for analytical chemistry
N-tetracosane-d50
isotopically labeled research standard
N-HEXANE-D14
Deuterated solvent for analytical chemistry
2-(Diphenylphosphino)benzoic acid
research reagent for phosphorus chemistry
(R)-(6,6'-Dimethoxy-[1,1'-biphenyl]-2,2'-diyl)bis(dicyclohexylphosphine)
chiral ligand for asymmetric catalysis
(2S)-1-(3,4-Dimethoxyphenyl)propan-2-amine
research compound for serotonin receptor studies
2-Amino-3-bromo-5-methylpyridine
research compound
1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-octadecadeuteriooctane
TVMXDCGIABBOFY-VAZJTQEUSA-N
[2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])[2H]
(2H18)Octane 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.