N-HEXANE-D14 is a fully deuterated form of n-hexane, commonly used as a solvent in nuclear magnetic resonance (NMR) spectroscopy to avoid proton signal interference. Its high isotopic purity makes it essential for analytical chemistry applications requiring inert and non-interfering solvents.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
N-HEXANE-D14 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
N-decane-d22
deuterated alkane reference standard
N-DODECANE-D26
deuterated standard for analytical chemistry
N-tetracosane-d50
isotopically labeled research standard
(2H18)Octane
Deuterated NMR solvent and internal standard
Succinic acid-d6
Deuterated internal standard for analytical chemistry
PMK glycidic acid
research compound for reference standard
1-bromo-3-(bromomethyl)-5-fluorobenzene
Research reagent
4-HYDROXY-N,N,2-TRIMETHYL-1H-BENZO[D]IMIDAZOLE-6-CARBOXAMIDE
Research compound
1,1,1,2,2,3,3,4,4,5,5,6,6,6-tetradecadeuteriohexane
VLKZOEOYAKHREP-ZLKPZJALSA-N
[2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])[2H]
N-HEXANE-D14 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.