N-DODECANE-D26 is a fully deuterated form of dodecane, where all 26 hydrogen atoms are replaced with deuterium. It is primarily used as an internal standard in analytical chemistry, particularly in nuclear magnetic resonance (NMR) spectroscopy and mass spectrometry, to improve accuracy in quantitative analysis.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
N-DODECANE-D26 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
N-tetracosane-d50
isotopically labeled research standard
(2H18)Octane
Deuterated NMR solvent and internal standard
N-decane-d22
deuterated alkane reference standard
N-HEXANE-D14
Deuterated solvent for analytical chemistry
2,2,6,6-d4-Morpholine
deuterated standard for analytical chemistry
Phenylacetic-d7 acid
deuterated standard for analytical chemistry
2-methylphenyl boronic acid
research compound
Methyl 5-bromo-1H-pyrrole-3-carboxylate
Research compound for chemical synthesis
N-DODECANE-D26(CAS 16416-30-1)의 국제 HS 코드는 2845.90입니다.
2845.90
2845 90 10
EU 세관 화학물질 목록 ECICS(2026-07 스냅숏, HS 2022)에 따른 분류입니다. 국가별 세부 세번과 제품 형태에 따라 최종 분류가 달라질 수 있습니다.
1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-hexacosadeuteriododecane
SNRUBQQJIBEYMU-DWXHPOBZSA-N
[2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])[2H]
N-DODECANE-D26 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.