N-DODECANE-D26 is a fully deuterated form of dodecane, where all 26 hydrogen atoms are replaced with deuterium. It is primarily used as an internal standard in analytical chemistry, particularly in nuclear magnetic resonance (NMR) spectroscopy and mass spectrometry, to improve accuracy in quantitative analysis.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 16416-30-1
N-tetracosane-d50
isotopically labeled research standard
(2H18)Octane
Deuterated NMR solvent and internal standard
N-decane-d22
deuterated alkane reference standard
N-HEXANE-D14
Deuterated solvent for analytical chemistry
2,2,6,6-d4-Morpholine
deuterated standard for analytical chemistry
Phenylacetic-d7 acid
deuterated standard for analytical chemistry
2-methylphenyl boronic acid
research compound
Methyl 5-bromo-1H-pyrrole-3-carboxylate
Research compound for chemical synthesis
1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-hexacosadeuteriododecane
SNRUBQQJIBEYMU-DWXHPOBZSA-N
[2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])[2H]