2,2,6,6-d4-Morpholine is a deuterated form of morpholine used as an analytical standard. Its incorporation of four deuterium atoms makes it valuable for quantitative analysis and internal standardization in mass spectrometry and nuclear magnetic resonance spectroscopy.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
2,2,6,6-d4-Morpholine 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Phenylacetic-d7 acid
deuterated standard for analytical chemistry
N-DODECANE-D26
deuterated standard for analytical chemistry
Quinolin-5-ylboronic Acid
Research reagent for Suzuki coupling
5-bromonicotinonitrile
research compound
Benzyl bromide-d7
deuterated research standard
5-Iodo-4-methylpyridin-2-amine
Research compound
1-Oxa-4-azacyclohexane
Solvent and chemical intermediate
Morpholine-d8 Hydrochloride
deuterated solvent reference standard
2,2,6,6-tetradeuteriomorpholine
YNAVUWVOSKDBBP-KHORGVISSA-N
[2H]C1(CNCC(O1)([2H])[2H])[2H]
2,2,6,6-d4-Morpholine 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.