Morpholine-d8 Hydrochloride is a deuterated research reagent used as a reference standard in nuclear magnetic resonance (NMR) spectroscopy. This isotopically labeled compound contains eight deuterium atoms, making it suitable for solvent calibration and analytical studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 1107650-56-5
MORPHOLINE-2,2,3,3,5,5,6,6-D8
deuterated research reagent
Spacer Phosphoramidite C3
oligonucleotide synthesis reagent
(1R,2R)-2-[[bis(trideuteriomethyl)amino]methyl]-1-(3-methoxyphenyl)cyclohexan-1-ol;hydrochloride
isotope-labeled reference standard
Potassium (R)-3-hydroxybutanoate
research chemical
Ethyl (2R)-oxirane-2-carboxylate
Research compound
2,2,6,6-d4-Morpholine
deuterated standard for analytical chemistry
1-Oxa-4-azacyclohexane
Solvent and chemical intermediate
2,2,3,3,5,5,6,6-octadeuteriomorpholine;hydrochloride
JXYZHMPRERWTPM-PHHTYKMFSA-N
[2H]C1(C(OC(C(N1)([2H])[2H])([2H])[2H])([2H])[2H])[2H].Cl