This compound is an isotope-labeled reference standard, specifically a deuterated form of the hydrochloride salt of a substituted cyclohexanol derivative. It is used in analytical chemistry and research as a certified standard for quantification and method validation.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 1109217-84-6
4-amino-2,3,5,6-tetradeuterio-N-(5-methoxypyrimidin-2-yl)benzenesulfonamide
isotope-labeled reference standard
2,5-DICHLOROANILINE-3,4,6-D3
isotope-labeled reference standard
Benz[e]acephenanthrylene-d12
isotope-labeled reference standard
Potassium (R)-3-hydroxybutanoate
research chemical
Ethyl (2R)-oxirane-2-carboxylate
Research compound
(E)-3,5-Dichloro-4-(3-ethoxy-2-methyl-3-oxoprop-1-en-1-yl)benzoic acid
Research compound for antiviral studies
(S)-4-(3-(1-(Hexyloxy)ethyl)-2-methoxyphenyl)thiazol-2-amine
research compound
Tramadol-d6 Hydrochloride
Active pharmaceutical ingredient
cis-(1R,2R)-2-[[bis(trideuteriomethyl)amino]methyl]-1-(3-methoxyphenyl)cyclohexan-1-ol;hydrochloride
PPKXEPBICJTCRU-LUHTVFDHSA-N
[2H]C([2H])([2H])N(C[C@H]1CCCC[C@@]1(C2=CC(=CC=C2)OC)O)C([2H])([2H])[2H].Cl