n-Tetracosane-d50 is a fully deuterated linear alkane used as an isotopically labeled research standard. Its high deuterium content makes it valuable for mass spectrometry and nuclear magnetic resonance (NMR) spectroscopy studies where tracking molecular behavior or quantifying natural abundance is required.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 16416-32-3
(2H18)Octane
Deuterated NMR solvent and internal standard
N-decane-d22
deuterated alkane reference standard
N-DODECANE-D26
deuterated standard for analytical chemistry
N-HEXANE-D14
Deuterated solvent for analytical chemistry
DL-MEVALONOLACTONE-4,4,5,5-D4
isotopically labeled research standard
(113C)ethane
isotopically labeled research standard
Semicarbazide-13C,15N2 Hydrochloride
isotopically labeled research standard
1,2,3-trichloropropane (d5)
isotopically labeled research standard
1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,17,17,18,18,19,19,20,20,21,21,22,22,23,23,24,24,24-pentacontadeuteriotetracosane
POOSGDOYLQNASK-KNUOVWDMSA-N
[2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])[2H]