1,2,3-Trichloropropane (d5) is a deuterium-labeled isotopologue of 1,2,3-trichloropropane, commonly used as an internal standard in analytical chemistry. Its primary significance lies in its application as an isotopic research standard for quantification and trace analysis.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
1,2,3-trichloropropane (d5) 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
DL-MEVALONOLACTONE-4,4,5,5-D4
isotopically labeled research standard
(113C)ethane
isotopically labeled research standard
5-ANDROSTEN-3BETA,17BETA-DIOL-16,16,17-D3
isotopically labeled research standard
Semicarbazide-13C,15N2 Hydrochloride
isotopically labeled research standard
1,1,2,2,3,3,4,4,4-nonadeuterio-N-(1,1,2,2,3,3,4,4,4-nonadeuteriobutyl)butan-1-amine
deuterated research reagent
Indeno[1,2,3-cd]pyrene-d12
Deuterated reference standard
2,3,4,5-tetradeuteriothiophene
deuterated thiophene research reagent
Dopamine-d4 hydrochloride
isotopically labeled research compound
1,2,3-trichloro-1,1,2,3,3-pentadeuteriopropane
CFXQEHVMCRXUSD-UXXIZXEISA-N
[2H]C([2H])(C([2H])(C([2H])([2H])Cl)Cl)Cl
1,2,3-trichloropropane (d5) 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.