Dopamine-d4 hydrochloride is an isotopically labeled form of dopamine, where four hydrogen atoms are replaced with deuterium. It is primarily used as a research compound for analytical and tracer studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 203633-19-6
L-Methionine-d3
isotopically labeled research compound
Mesityl-d10 oxide
isotopically labeled research compound
1,2-bis(trideuteriomethyl)benzene
isotopically labeled research compound
Propane-1,1-d2, 1-iodo-
isotopically labeled research compound
Benzene-d5, methyl-d3-
NMR solvent
Transportan (trifluoroacetate salt)
cell-penetrating peptide research tool
2-Aminopyridine-d6 naphthol
deuterated research compound
DL-Valine-2,3,4,4,4,5,5,5-d8
Deuterium-labeled amino acid standard
4-(2-amino-1,1,2,2-tetradeuterioethyl)benzene-1,2-diol;hydrochloride
CTENFNNZBMHDDG-URZLSVTISA-N
[2H]C([2H])(C1=CC(=C(C=C1)O)O)C([2H])([2H])N.Cl