2-Aminopyridine-d6 naphthol is a deuterated research compound, specifically an isotopically labeled derivative of 2-aminopyridine where all hydrogen atoms on the pyridine ring and the amino group are replaced by deuterium. It is primarily used as a laboratory reagent for stable isotope labeling studies in chemical and biochemical research.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
2-Aminopyridine-d6 naphthol 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
DL-Valine-2,3,4,4,4,5,5,5-d8
Deuterium-labeled amino acid standard
Oxalohydroximoyl chloride
research reagent for synthesis
3-bromo-9H-fluorene
research compound
HEPES (D18)
deuterated buffer reagent
2-AMINOPYRIDINE
pharmaceutical intermediate for antihistamines and other drugs
2-Pyridinamine-d4
Deuterated research standard for analytical chemistry
N,N,3,4,5,6-hexadeuteriopyridin-2-amine
ICSNLGPSRYBMBD-UDDMDDBKSA-N
[2H]C1=C(C(=NC(=C1[2H])N([2H])[2H])[2H])[2H]
2-Aminopyridine-d6 naphthol 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.