2-Pyridinamine-d4 is a deuterated form of 2-aminopyridine where all four hydrogen atoms on the pyridine ring are replaced with deuterium. It is primarily used as an internal standard or labeled reagent in analytical chemistry, particularly for mass spectrometry and nuclear magnetic resonance spectroscopy.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 87802-54-8
L-Leucine-5,5,5-d3
Deuterated amino acid research reagent
Piperidine-4-sulfonic acid amide
research compound
1-cyclopropyl-4-isothiocyanatonaphthalene
research compound
Methyl 2-((5-amino-4-(4-cyclopropylnaphthalen-1-yl)-4H-1,2,4-triazol-3-yl)thio)acetate
Research compound
2-Aminopyridine-d6 naphthol
deuterated research compound
2-AMINOPYRIDINE
pharmaceutical intermediate for antihistamines and other drugs
3,4,5,6-tetradeuteriopyridin-2-amine
ICSNLGPSRYBMBD-RHQRLBAQSA-N
[2H]C1=C(C(=NC(=C1[2H])N)[2H])[2H]