L-Leucine-5,5,5-d3 is a deuterated amino acid used as a research reagent. It is a labeled form of L-leucine where three hydrogen atoms at the 5-position are replaced with deuterium, enabling tracing in metabolic studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 87828-86-2
Piperidine-4-sulfonic acid amide
research compound
1-cyclopropyl-4-isothiocyanatonaphthalene
research compound
Methyl 2-((5-amino-4-(4-cyclopropylnaphthalen-1-yl)-4H-1,2,4-triazol-3-yl)thio)acetate
Research compound
Fmoc-Tyr(tBu)-Ser(Psi(Me,Me)pro)-OH
Research reagent for peptide synthesis
L-LEUCINE-D7
isotopically labeled amino acid
Deuterated L-leucine
deuterated compound for research
2-amino-2,3,3,4,5,5,5-heptadeuterio-4-(trideuteriomethyl)pentanoic acid
deuterated research compound
D-LEUCINE
metabolite research compound
(2S)-2-amino-5,5,5-trideuterio-4-methylpentanoic acid
ROHFNLRQFUQHCH-LONBSJBQSA-N
[2H]C([2H])([2H])C(C)C[C@@H](C(=O)O)N