L-Leucine-d7 is a deuterium-labeled isotopologue of the essential amino acid L-leucine, commonly used as a research reagent in metabolic and analytical studies. Its primary significance lies in serving as an internal standard or tracer for mass spectrometry due to the incorporation of seven deuterium atoms.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
L-LEUCINE-D7 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
5-Iodo-6-methylpyridin-2-ol
research compound
2-(2-ISOPROPYL-4-METHOXYPHENOXY)ACETONITRILE
research compound
4-(6-hydroxy-2-naphthyl)-1,3-benzenediol
research compound
5-Chloro-1-pentene
Chemical research reagent
Deuterated L-leucine
deuterated compound for research
2-amino-2,3,3,4,5,5,5-heptadeuterio-4-(trideuteriomethyl)pentanoic acid
deuterated research compound
D-LEUCINE
metabolite research compound
DL-Leucine
Pharmaceutical intermediate for peptide synthesis
(2S)-2-amino-4,5,5,5-tetradeuterio-4-(trideuteriomethyl)pentanoic acid
ROHFNLRQFUQHCH-RHMGQHGKSA-N
[2H]C([2H])([2H])C([2H])(C[C@@H](C(=O)O)N)C([2H])([2H])[2H]
L-LEUCINE-D7 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.