Leucine-d10 is a deuterated compound used primarily as a research reagent. Its structure features ten deuterium atoms replacing hydrogen, making it valuable for tracing and analytical studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 29909-01-1
2,5-Difluorobenzoic acid
research compound
3-(Tris(hydroxymethyl)methylamino)-1-propanesulfonic acid
Biological buffer
Isopropyl bromoacetate
research reagent
4-Aminophenylsulphur pentafluoride
Research chemical for synthesis
D-LEUCINE
metabolite research compound
DL-Leucine
Pharmaceutical intermediate for peptide synthesis
류신
nutritional supplement and flavoring agent
L-Leucine-5,5,5-d3
Deuterated amino acid research reagent
2-amino-2,3,3,4,5,5,5-heptadeuterio-4-(trideuteriomethyl)pentanoic acid
ROHFNLRQFUQHCH-SHJFKSRGSA-N
[2H]C([2H])([2H])C([2H])(C([2H])([2H])[2H])C([2H])([2H])C([2H])(C(=O)O)N