This compound is a deuterium-labeled amino acid, specifically a deuterated form of valine, used as an internal standard in analytical chemistry. Its primary significance lies in providing a stable isotopic reference for mass spectrometry and nuclear magnetic resonance spectroscopy.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
DL-Valine-2,3,4,4,4,5,5,5-d8 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Oxalohydroximoyl chloride
research reagent for synthesis
3-bromo-9H-fluorene
research compound
HEPES (D18)
deuterated buffer reagent
(2S,4S)-1-[(tert-butoxy)carbonyl]-4-fluoropyrrolidine-2-carboxylic acid
research compound
L-Valine-d8
Stable isotope labeled research compound
DL-Valine
Nutritional supplement and flavoring agent
D-Valine
Biochemical research reagent
발린
Nutritional supplement and dietary additive
DL-Valine-2,3,4,4,4,5,5,5-d8(CAS 203784-63-8)의 국제 HS 코드는 2845.90입니다.
2845.90
2845 90 10
EU 세관 화학물질 목록 ECICS(2026-07 스냅숏, HS 2022)에 따른 분류입니다. 국가별 세부 세번과 제품 형태에 따라 최종 분류가 달라질 수 있습니다.
2-amino-2,3,4,4,4-pentadeuterio-3-(trideuteriomethyl)butanoic acid
KZSNJWFQEVHDMF-PIODKIDGSA-N
[2H]C([2H])([2H])C([2H])(C([2H])([2H])[2H])C([2H])(C(=O)O)N
DL-Valine-2,3,4,4,4,5,5,5-d8 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.