HEPES (D18) is a deuterated form of the common biological buffer HEPES, where all 18 hydrogen atoms are replaced with deuterium. It is primarily used as a deuterated buffer reagent in NMR spectroscopy and other analytical techniques to minimize background signals.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
HEPES (D18) 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
(2S,4S)-1-[(tert-butoxy)carbonyl]-4-fluoropyrrolidine-2-carboxylic acid
research compound
(2S,4R)-1-[(tert-butoxy)carbonyl]-4-fluoropyrrolidine-2-carboxylic acid
research compound
3-Methoxyphenethylamine
Research compound
Methyl 3-phenanthryl ketone
research compound
HEPES
zwitterionic biological buffer
Sodium 2-(4-(2-hydroxyethyl)piperazin-1-yl)ethanesulfonate
dipolar ionic buffer
deuterio 1,1,2,2-tetradeuterio-2-[2,2,3,3,5,5,6,6-octadeuterio-4-(1,1,2,2-tetradeuterio-2-deuteriooxyethyl)piperazin-1-yl]ethanesulfonate
JKMHFZQWWAIEOD-MMODJCGESA-N
[2H]C1(C(N(C(C(N1C([2H])([2H])C([2H])([2H])O[2H])([2H])[2H])([2H])[2H])C([2H])([2H])C([2H])([2H])S(=O)(=O)O[2H])([2H])[2H])[2H]
HEPES (D18) 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.