This compound is a fluorinated pyrrolidine derivative with a tert-butoxycarbonyl (Boc) protecting group and a carboxylic acid functional group. It is a research reagent used in organic synthesis and pharmaceutical development, particularly for the preparation of building blocks in drug discovery.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 203866-14-2
3-Methoxyphenethylamine
Research compound
Methyl 3-phenanthryl ketone
research compound
4-BROMOSTYRENE
research compound for synthesis
5-Chloropentyl acetate
chemical intermediate
(2R,4S)-1-(tert-butoxycarbonyl)-4-fluoropyrrolidine-2-carboxylic acid
research compound
(2R,4R)-1-(tert-Butoxycarbonyl)-4-fluoropyrrolidine-2-carboxylic acid
Pharmaceutical intermediate for peptide synthesis
(2S,4S)-1-[(tert-butoxy)carbonyl]-4-fluoropyrrolidine-2-carboxylic acid
research compound
(2S,4R)-4-fluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid
YGWZXQOYEBWUTH-RQJHMYQMSA-N
CC(C)(C)OC(=O)N1C[C@@H](C[C@H]1C(=O)O)F