l-Methionine-d3 is a deuterated form of the amino acid L-methionine, commonly used as an isotopically labeled research compound. It is primarily applied in analytical and metabolic studies to trace biochemical pathways or quantify methionine-related processes.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 13010-53-2
Dopamine-d4 hydrochloride
isotopically labeled research compound
Rac Ambrisentan-d3 Methyl Ester
isotopically labeled research compound
Butyryl-L-carnitine-d3 (chloride)
isotopically labeled research compound
Carbon-13C monoxide
isotopically labeled research compound
Propan-2-yl-oxocyclobutane carboxylate
research compound
1-Bromohexane-d13
Deuterated research reagent
Methyl 4,4-difluoropiperidine-2-carboxylate
research compound
(-)-tert-Butyl glycidyl ether
research compound
(2S)-2-amino-4-(trideuteriomethylsulfanyl)butanoic acid
FFEARJCKVFRZRR-OSIBIXDNSA-N
[2H]C([2H])([2H])SCC[C@@H](C(=O)O)N