Toluene-d8 is a deuterated form of toluene, a volatile organic compound belonging to the methylbenzenes. It is primarily used as an NMR solvent due to its deuterium labeling, which minimizes interfering signals in nuclear magnetic resonance spectroscopy.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 2037-26-5
Nitro(2H5)benzene
NMR solvent
(2H3)Acetonitrile
NMR solvent
Trifluoroacetic acid-d
NMR solvent
Chloroform-D
NMR solvent
Transportan (trifluoroacetate salt)
cell-penetrating peptide research tool
2-Aminopyridine-d6 naphthol
deuterated research compound
DL-Valine-2,3,4,4,4,5,5,5-d8
Deuterium-labeled amino acid standard
Oxalohydroximoyl chloride
research reagent for synthesis
1,2,3,4,5-pentadeuterio-6-(trideuteriomethyl)benzene
YXFVVABEGXRONW-JGUCLWPXSA-N
[2H]C1=C(C(=C(C(=C1[2H])[2H])C([2H])([2H])[2H])[2H])[2H]