This compound is a deuterium-labeled research standard, specifically a trideuterated form of an androstane derivative featuring two hydroxyl groups and a steroidal backbone. It is primarily used as an isotopically labeled standard in analytical and laboratory research.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 73609-45-7
Octanoyl L-Carnitine-d3 Chloride
isotopically labeled research standard
N-tetracosane-d50
isotopically labeled research standard
1,2,3-trichloropropane (d5)
isotopically labeled research standard
DL-MEVALONOLACTONE-4,4,5,5-D4
isotopically labeled research standard
N-Tris(hydroxymethyl)methyl-2-aminoethanesulfonic acid
biological buffer substance
HEPES
zwitterionic biological buffer
(S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(1H-pyrrolo[2,3-b]pyridin-3-yl)propanoic acid
Fmoc-protected amino acid derivative
5-(3-Aminophenyl)tetrazole
research compound
(3S,8R,9S,10R,13S,14S,17S)-16,16,17-trideuterio-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthrene-3,17-diol
QADHLRWLCPCEKT-KJEDCRHKSA-N
[2H][C@]1([C@]2(CC[C@H]3[C@H]([C@@H]2CC1([2H])[2H])CC=C4[C@@]3(CC[C@@H](C4)O)C)C)O
—