This compound is an Fmoc-protected amino acid derivative, specifically this compound. It is used as a research reagent in peptide synthesis, where the Fmoc group serves as a temporary protecting group for the amino function.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 737007-45-3
Fmoc-D-Trp-OH
research compound for peptide synthesis
Fmoc-L-tryptophan
Protected amino acid for peptide synthesis
(2S)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-4-[(triphenylmethyl)carbamoyl]butanoic acid
Fmoc-protected amino acid derivative
N-alpha-(9-Fluorenylmethyloxycarbonyl)-L-glutamic-acid-alpha allyl ester
Fmoc-protected amino acid derivative
(R)-Nomega-(t-Butoxycarbonyl)-Nalpha-(9-fluorenylmethoxycarbonyl)-alpha-methylornithin
Fmoc-protected amino acid derivative
(S)-4-((((9H-fluoren-9-yl)methoxy)carbonyl)amino)-5-amino-5-oxopentanoic acid
Fmoc-protected amino acid derivative
5-(3-Aminophenyl)tetrazole
research compound
Rhodium(II) perfluorobutyrate dimer
Research reagent for organic synthesis
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(1H-pyrrolo[2,3-b]pyridin-3-yl)propanoic acid
SEWQKWXKJVYKOO-QFIPXVFZSA-N
C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CC4=CNC5=C4C=CC=N5)C(=O)O