Octanoyl L-Carnitine-d3 Chloride is an isotopically labeled research standard, deuterated at the methyl group attached to the quaternary nitrogen. It is a salt form of the L-carnitine ester with octanoic acid, used primarily as a reference compound in analytical chemistry and metabolic studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Octanoyl L-Carnitine-d3 Chloride 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Myristoyl-L-carnitine-d3 Hydrochloride
stable isotope labeled research compound
Palmitoyl-L-carnitine-d3 Hydrochloride
stable isotope labeled research compound
Stearoyl-L-carnitine-d3 (chloride)
stable isotope labeled reference standard
Butyryl-L-carnitine-d3 (chloride)
isotopically labeled research compound
N-tetracosane-d50
isotopically labeled research standard
1,2,3-trichloropropane (d5)
isotopically labeled research standard
DL-MEVALONOLACTONE-4,4,5,5-D4
isotopically labeled research standard
(113C)ethane
isotopically labeled research standard
[(2R)-3-carboxy-2-octanoyloxypropyl]-dimethyl-(trideuteriomethyl)azanium chloride
MYMFUYYXIJGKKU-HZUATLIXSA-N
[2H]C([2H])([2H])[N+](C)(C)C[C@@H](CC(=O)O)OC(=O)CCCCCCC.[Cl-]
—
Octanoyl L-Carnitine-d3 Chloride 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.