2,3,4,5-Tetradeuteriothiophene is a deuterated form of thiophene used as a research reagent. Its primary significance lies in providing a labeled compound for spectroscopic studies and mechanistic investigations.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
2,3,4,5-tetradeuteriothiophene 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Dopamine-d4 hydrochloride
isotopically labeled research compound
Benzene-d5, methyl-d3-
NMR solvent
Transportan (trifluoroacetate salt)
cell-penetrating peptide research tool
2-Aminopyridine-d6 naphthol
deuterated research compound
THIOPHENE-2,5-D2
deuterated research compound
Thiofuran
pharmaceutical intermediate and solvent
2,3,4,5-tetradeuteriothiophene
YTPLMLYBLZKORZ-RHQRLBAQSA-N
[2H]C1=C(SC(=C1[2H])[2H])[2H]
2,3,4,5-tetradeuteriothiophene 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.