Succinic acid-d6 is a deuterated form of succinic acid where six hydrogen atoms are replaced by deuterium. It is primarily used as an internal standard in analytical chemistry, enabling accurate quantification through isotopic dilution methods.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 21668-90-6
Hexanedioic-2,2,3,3,4,4,5,5-d8 acid-1,6-d2
isotopic labeled analytical reference standard
1,2-Diaminobenzene (D4, 98%)
Deuterated internal standard for analytical chemistry
PMK glycidic acid
research compound for reference standard
1-bromo-3-(bromomethyl)-5-fluorobenzene
Research reagent
4-HYDROXY-N,N,2-TRIMETHYL-1H-BENZO[D]IMIDAZOLE-6-CARBOXAMIDE
Research compound
2-(cyclohexen-1-yl)ethynyl-triethyl-silane
organosilicon research compound
Dipotassium succinate trihydrate
food additive and buffering agent
Hypromellose acetate succinate
pharmaceutical excipient
dideuterio 2,2,3,3-tetradeuteriobutanedioate
KDYFGRWQOYBRFD-DTDGFSOZSA-N
[2H]C([2H])(C(=O)O[2H])C([2H])([2H])C(=O)O[2H]