2-(Diphenylphosphino)benzoic acid is a research reagent used in phosphorus chemistry. It features a carboxylic acid group and three aromatic rings, contributing to its utility in coordination chemistry studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 17261-28-8
(R)-(6,6'-Dimethoxy-[1,1'-biphenyl]-2,2'-diyl)bis(dicyclohexylphosphine)
chiral ligand for asymmetric catalysis
(2S)-1-(3,4-Dimethoxyphenyl)propan-2-amine
research compound for serotonin receptor studies
2-Amino-3-bromo-5-methylpyridine
research compound
3-Bromo-2-fluoro-5-methylpyridine
chemical synthesis intermediate
2-diphenylphosphanylbenzoic acid
UYRPRYSDOVYCOU-UHFFFAOYSA-N
C1=CC=C(C=C1)P(C2=CC=CC=C2)C3=CC=CC=C3C(=O)O