This compound is a chiral amine used in research as a tool for studying serotonin receptor interactions. It features an aromatic ring substituted with two methoxy groups and a primary amine side chain, giving it specific structural properties relevant to neurochemical investigations.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
(2S)-1-(3,4-Dimethoxyphenyl)propan-2-amine 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
2-Amino-3-bromo-5-methylpyridine
research compound
3-Bromo-2-fluoro-5-methylpyridine
chemical synthesis intermediate
2-Chloro-3-fluoropyridine
Research compound
2-(3,4-dimethylphenyl)acetic acid
Research compound
3,4-Dimethoxyamphetamine, (R)-
research compound
(2S)-1-(3,4-dimethoxyphenyl)propan-2-amine
KAZPHAGSWZTKDW-QMMMGPOBSA-N
C[C@@H](CC1=CC(=C(C=C1)OC)OC)N
(2S)-1-(3,4-Dimethoxyphenyl)propan-2-amine 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.