Boc-L-valine is a protected amino acid commonly used in peptide synthesis. It features a tert-butyloxycarbonyl (Boc) protecting group attached to the amino group of L-valine, enabling selective peptide bond formation during solid-phase or solution-phase synthesis.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Boc-L-valine 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
N-(tert-Butyloxycarbonyl)-L-threonine
Protected amino acid for peptide synthesis
(2S)-2-{[(tert-butoxy)carbonyl]amino}pentanoic acid
protected amino acid for peptide synthesis
(2R)-6-{[(tert-butoxy)carbonyl]amino}-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)hexanoic acid
protected amino acid for peptide synthesis
FMOC-D-allo-Isoleucine
protected amino acid for peptide synthesis
BI-DIME
Research ligand for chemical synthesis
6-bromo-2,3-dihydro-4H-1-Benzothiopyran-4-one
research compound
(2S)-3-[4-(AMINOMETHYL)PHENYL]-2-[(TERT-BUTOXY)CARBONYLAMINO]PROPANOIC ACID
Research compound for peptide synthesis
2-Bromo-4-methylpyridine-d6
deuterated research compound
Boc-L-valine(CAS 13734-41-3)의 국제 HS 코드는 2924.19입니다.
2924.19
2924 19 00
EU 세관 화학물질 목록 ECICS(2026-07 스냅숏, HS 2022)에 따른 분류입니다. 국가별 세부 세번과 제품 형태에 따라 최종 분류가 달라질 수 있습니다.
(2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid
SZXBQTSZISFIAO-ZETCQYMHSA-N
CC(C)[C@@H](C(=O)O)NC(=O)OC(C)(C)C
Boc-L-valine 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.