BI-DIME is a chiral benzoxaphosphole compound used as a research ligand in chemical synthesis. It features a tert-butyl group and two methoxy-substituted phenyl rings, contributing to its utility in asymmetric catalysis and coordination chemistry.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
BI-DIME 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
6-bromo-2,3-dihydro-4H-1-Benzothiopyran-4-one
research compound
(2S)-3-[4-(AMINOMETHYL)PHENYL]-2-[(TERT-BUTOXY)CARBONYLAMINO]PROPANOIC ACID
Research compound for peptide synthesis
2-Bromo-4-methylpyridine-d6
deuterated research compound
3-methyl-1,2,4-thiadiazole-5-carbohydrazide
chemical research reagent
(R)-3-(tert-Butyl)-4-(2,6-dimethoxyphenyl)-2,2-dimethyl-2,3-dihydrobenzo[d][1,3]oxaphosphole
Research compound
(3S)-3-tert-butyl-4-(2,6-dimethoxyphenyl)-2H-1,3-benzoxaphosphole
BWPDUHMFZCEKIP-HSZRJFAPSA-N
CC(C)(C)[P@@]1COC2=CC=CC(=C21)C3=C(C=CC=C3OC)OC
BI-DIME 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.