2-Bromo-4-methylpyridine-d6 is a deuterated research compound in which all hydrogen atoms of the methyl group and the pyridine ring are replaced by deuterium. This isotopically labeled analogue is used as a tracer or internal standard in analytical chemistry and metabolic studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
2-Bromo-4-methylpyridine-d6 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
3-methyl-1,2,4-thiadiazole-5-carbohydrazide
chemical research reagent
3-bromo-1,7-naphthyridin-8-ol
research compound
3-(benzyloxy)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine
research compound
Chloro[(4,5-bis(diphenylphosphino)-9,9-dimethyl xanthene)-2-(2-amino-1,1-biphenyl)]palladium(II)
cross-coupling catalyst
2-Bromo-4-methylpyridine
research compound
2-bromo-3,5,6-trideuterio-4-(trideuteriomethyl)pyridine
LSZMVESSGLHDJE-RLTMCGQMSA-N
[2H]C1=C(N=C(C(=C1C([2H])([2H])[2H])[2H])Br)[2H]
2-Bromo-4-methylpyridine-d6 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.