FMOC-D-allo-Isoleucine is a protected amino acid derivative used primarily in solid-phase peptide synthesis. Its fluorenylmethoxycarbonyl (Fmoc) group allows temporary protection of the amino functionality during peptide chain assembly.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
FMOC-D-allo-Isoleucine 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Fmoc-L-valine
Peptide synthesis intermediate
(2R)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-methylbutanoic acid
Peptide synthesis building block
Fmoc-Ile-Gly-OH
Research reagent for peptide synthesis
Boc-L-valine
protected amino acid for peptide synthesis
(2S)-2-{[(tert-butoxy)carbonyl]amino}pentanoic acid
protected amino acid for peptide synthesis
(2R)-6-{[(tert-butoxy)carbonyl]amino}-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)hexanoic acid
protected amino acid for peptide synthesis
2-Phenyl-2-(2-piperidyl)acetamide-d10;
Deuterated research compound
2,6-Di-iso-propylphenol-d18
isotopically labeled reference standard
(2R,3S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylpentanoic acid
QXVFEIPAZSXRGM-ORAYPTAESA-N
CC[C@H](C)[C@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13
FMOC-D-allo-Isoleucine 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.