2,6-Di-iso-propylphenol-d18 is an isotopically labeled reference standard where all hydrogen atoms are replaced with deuterium. It is primarily used in analytical chemistry and mass spectrometry as a certified internal standard for quantification and calibration.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 1189467-93-3
1,3-Dinitrobenzene-d4
isotopically labeled reference standard
(2H8)Naphthalene
isotopically labeled reference standard
L-Phenyl-d5-alanine-2,3,3-d3
isotopically labeled reference standard
Acyclovir-d4 L-Leucinate
isotopically labeled reference standard
4-amino-2,3,5,6-tetradeuterio-N-(5-methoxypyrimidin-2-yl)benzenesulfonamide
isotope-labeled reference standard
Amfepramone-d10 Hydrochloride
deuterated research standard
3-Bromo-5-chloropyridine-2-carboxylic acid
Pharmaceutical research intermediate
5-Bromo-3-chloropyridine-2-carboxylic acid
research compound
1,2,3-trideuterio-5-deuteriooxy-4,6-bis(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)benzene
OLBCVFGFOZPWHH-YXZMVERASA-N
[2H]C1=C(C(=C(C(=C1[2H])C([2H])(C([2H])([2H])[2H])C([2H])([2H])[2H])O[2H])C([2H])(C([2H])([2H])[2H])C([2H])([2H])[2H])[2H]