1,3-Dinitrobenzene-d4 is a deuterium-labeled version of 1,3-dinitrobenzene, where the four hydrogen atoms on the aromatic ring are replaced by deuterium. It is primarily used as an isotopically labeled internal standard in analytical chemistry and mass spectrometry for quantitative analysis.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
1,3-Dinitrobenzene-d4 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
3-Nitroaniline-2,4,5,6-d4
deuterated research compound
2,6-Di-iso-propylphenol-d18
isotopically labeled reference standard
4-Acetaminophen-d3 Sulfate Potassium Salt
isotopically labeled reference standard
Acyclovir-d4 L-Leucinate
isotopically labeled reference standard
1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl](213C)pyrimidine-2,4-dione
isotopically labeled reference standard
4-(Diethylamino)benzoic acid
research compound for peptide synthesis
Benzene-1,3-d2-2-bromo-5-methyl-(9CI)
research compound
Taurocyamine
Research compound for enzyme studies
1,2,3,5-tetradeuterio-4,6-dinitrobenzene
WDCYWAQPCXBPJA-RHQRLBAQSA-N
[2H]C1=C(C(=C(C(=C1[2H])[N+](=O)[O-])[2H])[N+](=O)[O-])[2H]
1,3-Dinitrobenzene-d4 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.