This compound is a deuterium-labeled aromatic compound used as a research reagent. Its structure features a bromine atom and a methyl group on a deuterated benzene ring, making it useful for isotopic labeling studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Benzene-1,3-d2-2-bromo-5-methyl-(9CI) 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Taurocyamine
Research compound for enzyme studies
(3-Benzyloxypropyl)triphenylphosphonium bromide
Research reagent for organic synthesis
3-Aminophthalic acid
chemiluminescence assay reagent
5-(2-NITRO-PROPENYL)-BENZO(1,3)DIOXOLE
research compound
4-BROMOTOLUENE
solvent and chemical intermediate
4-BROMOTOLUENE-2,3,5,6-D4
deuterated research standard
4-Bromotoluene (Methyl D3)
Deuterated reference standard
4-Bromotoluene-d7
Deuterated analytical reference standard
2-bromo-1,3-dideuterio-5-methylbenzene
ZBTMRBYMKUEVEU-KFRNQKGQSA-N
[2H]C1=CC(=CC(=C1Br)[2H])C
—
Benzene-1,3-d2-2-bromo-5-methyl-(9CI) 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.