4-Bromotoluene-2,3,5,6-d4 is a deuterated research standard, specifically a tetradeuterated analog of 4-bromotoluene where four hydrogen atoms on the benzene ring are replaced by deuterium. It is primarily used as an internal standard or reference compound in analytical chemistry, particularly in mass spectrometry and nuclear magnetic resonance spectroscopy, due to its stable isotope labeling.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
4-BROMOTOLUENE-2,3,5,6-D4 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
5-CHLORO-2-HYDROXY-4-IODOPYRIDINE
Research compound for synthesis
1-(3-chloro-5-(trifluoromethyl)phenyl)-2,2,2-trifluoroethanone
research compound
Tert-butyl 2,2,3,3,5,5,6,6-octadeuteriopiperazine-1-carboxylate
deuterated research reagent
8-Hydroxyquinoline 1-oxide
research compound
4-Bromotoluene (Methyl D3)
Deuterated reference standard
4-Bromotoluene-d7
Deuterated analytical reference standard
Benzene-1,3-d2-2-bromo-5-methyl-(9CI)
research compound
4-BROMOTOLUENE
solvent and chemical intermediate
1-bromo-2,3,5,6-tetradeuterio-4-methylbenzene
ZBTMRBYMKUEVEU-QFFDRWTDSA-N
[2H]C1=C(C(=C(C(=C1C)[2H])[2H])Br)[2H]
4-BROMOTOLUENE-2,3,5,6-D4 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.