This compound is a deuterated form of 4-bromotoluene, where the methyl group contains three deuterium atoms. It is primarily used as a reference standard in analytical chemistry and research applications.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
4-Bromotoluene (Methyl D3) 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
3-Bromo-1,1'-biphenyl-d9
Deuterated reference standard
1-(2-chlorophenyl)-2,3,4,5,6-pentadeuteriobenzene
Deuterated reference standard
1,2,4-TRIAZOLE-D3
Deuterated reference standard
[3-(trideuteriomethyl)phenyl]methanol
Deuterated reference standard
Propylmagnesium chloride
Grignard reagent for chemical synthesis
Tripropylphosphine
Research reagent for coordination chemistry
2-Bromopyridine-5-boronic acid
Suzuki cross-coupling reagent
(R)-(+)-alpha,alpha-Diphenyl-2-pyrrolidinemethanol
research compound
1-bromo-4-(trideuteriomethyl)benzene
ZBTMRBYMKUEVEU-FIBGUPNXSA-N
[2H]C([2H])([2H])C1=CC=C(C=C1)Br
4-Bromotoluene (Methyl D3) 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.