This compound is a deuterated reference standard, specifically a brominated biphenyl derivative where all nine hydrogen atoms are replaced with deuterium. It is primarily used in analytical chemistry and research as an internal standard or tracer for mass spectrometry and other quantitative methods.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
3-Bromo-1,1'-biphenyl-d9 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
1-(2-chlorophenyl)-2,3,4,5,6-pentadeuteriobenzene
Deuterated reference standard
4-Bromotoluene (Methyl D3)
Deuterated reference standard
1,2,4-TRIAZOLE-D3
Deuterated reference standard
[3-(trideuteriomethyl)phenyl]methanol
Deuterated reference standard
Dichloro(dimethylglyoxime)(dimethylglyoximato)cobalt(III)
vitamin B12 model research compound
1H-Purine-6-carboxylic acid
research compound
Propanoic acid, 2-fluoro-, methyl ester
Research reagent for organic synthesis
Phenylzinc iodide
cross-coupling reagent
1-bromo-2,3,4,6-tetradeuterio-5-(2,3,4,5,6-pentadeuteriophenyl)benzene
USYQKCQEVBFJRP-LOIXRAQWSA-N
[2H]C1=C(C(=C(C(=C1[2H])[2H])C2=C(C(=C(C(=C2[2H])[2H])[2H])Br)[2H])[2H])[2H]
3-Bromo-1,1'-biphenyl-d9 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.