This compound is a deuterated reference standard, specifically a brominated biphenyl derivative where all nine hydrogen atoms are replaced with deuterium. It is primarily used in analytical chemistry and research as an internal standard or tracer for mass spectrometry and other quantitative methods.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 2363789-28-8
1-(2-chlorophenyl)-2,3,4,5,6-pentadeuteriobenzene
Deuterated reference standard
4-Bromotoluene (Methyl D3)
Deuterated reference standard
1,2,4-TRIAZOLE-D3
Deuterated reference standard
[3-(trideuteriomethyl)phenyl]methanol
Deuterated reference standard
Dichloro(dimethylglyoxime)(dimethylglyoximato)cobalt(III)
vitamin B12 model research compound
1H-Purine-6-carboxylic acid
research compound
Propanoic acid, 2-fluoro-, methyl ester
Research reagent for organic synthesis
Phenylzinc iodide
cross-coupling reagent
1-bromo-2,3,4,6-tetradeuterio-5-(2,3,4,5,6-pentadeuteriophenyl)benzene
USYQKCQEVBFJRP-LOIXRAQWSA-N
[2H]C1=C(C(=C(C(=C1[2H])[2H])C2=C(C(=C(C(=C2[2H])[2H])[2H])Br)[2H])[2H])[2H]