This compound is a deuterium-labeled derivative of piperazine, specifically designed for research applications. Its primary significance is as a stable isotope-labeled reagent used in analytical and biochemical studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 1126621-86-0
8-Hydroxyquinoline 1-oxide
research compound
2,4-Dichloro-6-(naphthalen-2-yl)-1,3,5-triazine
research compound
(1R)-1-(3-chlorophenyl)propan-1-ol
chiral research compound
3-Fluoro-4-methoxyphenylmagnesium bromide
Grignard reagent for organic synthesis
1-Boc-piperazine
protecting group for piperazine synthesis
Tert-butyl Piperazine-1-carboxylate Hydrochloride
Pharmaceutical intermediate for drug synthesis
tert-butyl 2,2,3,3,5,5,6,6-octadeuteriopiperazine-1-carboxylate
CWXPZXBSDSIRCS-DUSUNJSHSA-N
[2H]C1(C(N(C(C(N1)([2H])[2H])([2H])[2H])C(=O)OC(C)(C)C)([2H])[2H])[2H]