This compound is a chiral alcohol featuring a chlorophenyl ring, primarily used as a research reagent in stereochemistry studies. Its structure is marked with defined stereochemistry and contains an alcohol group, an aromatic ring, and a halogen substituent.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 112777-67-0
1-((R)-3-Amino-pyrrolidin-1-yl)-ethanone
chiral research compound
3-Fluoro-4-methoxyphenylmagnesium bromide
Grignard reagent for organic synthesis
2,6-dipyridin-2-yl-4-pyridin-4-ylpyridine
Research compound for supramolecular chemistry
D-FMOC-methionine
Protected amino acid for peptide synthesis
(2S)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-(naphthalen-2-yl)propanoic acid
Research compound for peptide synthesis
(1S)-1-(3-chlorophenyl)propan-1-ol
pharmaceutical intermediate
(1R)-1-(3-chlorophenyl)propan-1-ol
APYGJPRINQKIQF-SECBINFHSA-N
CC[C@H](C1=CC(=CC=C1)Cl)O
—