This compound is a research reagent designed for supramolecular chemistry, featuring a structure with multiple aromatic and heterocyclic rings that facilitate alkylation of pendant pyridyl groups. It serves as a building block for developing supramolecular architectures through controlled self-assembly processes.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 112881-51-3
D-FMOC-methionine
Protected amino acid for peptide synthesis
(2S)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-(naphthalen-2-yl)propanoic acid
Research compound for peptide synthesis
Trans-3,4-Difluorocinnamic acid
research compound
(2E)-3-(2,5-difluorophenyl)prop-2-enoic acid
research compound
2,6-dipyridin-2-yl-4-pyridin-4-ylpyridine
DPPKPCLKZOLTMB-UHFFFAOYSA-N
C1=CC=NC(=C1)C2=CC(=CC(=N2)C3=CC=CC=N3)C4=CC=NC=C4
—