trans-3,4-Difluorocinnamic acid is a research compound featuring a difluorinated aromatic ring. Its significance arises from the use of partial fluoro-substitution as a probe to explore the structural landscape in crystal engineering studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Trans-3,4-Difluorocinnamic acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
(2E)-3-(2,5-difluorophenyl)prop-2-enoic acid
research compound
2,6-Diacetylpyridine
research compound
(2S,2'S)-Ethambutol-d10 (1,1,1',1',2,2'-d6; ethylene-d4)
isotope-labeled reference compound
SODIUM PYRUVATE
cell culture energy source and antioxidant
(E)-3-(3,4-difluorophenyl)prop-2-enoic acid
HXBOHZQZTWAEHJ-DUXPYHPUSA-N
C1=CC(=C(C=C1/C=C/C(=O)O)F)F
Trans-3,4-Difluorocinnamic acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.