4-Bromotoluene-d7 is a deuterated analytical reference standard used primarily in research and analytical chemistry. Its structure consists of a brominated aromatic ring with a fully deuterated methyl group, providing a stable isotope-labeled compound for precise analytical measurements.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
4-Bromotoluene-d7 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
MAC glucuronide linker-2
antibody-drug conjugate linker reagent
1,7-Phenanthroline
research compound
MPTP hydrochloride
research compound
(1A-methyl-6-oxo-3-phenoxy-1,1a,6,6a-tetrahydroindeno[1,2-b]azirine-6a-carbonyl)glycine
research compound
Benzene-1,3-d2-2-bromo-5-methyl-(9CI)
research compound
4-BROMOTOLUENE
solvent and chemical intermediate
4-BROMOTOLUENE-2,3,5,6-D4
deuterated research standard
4-Bromotoluene (Methyl D3)
Deuterated reference standard
1-bromo-2,3,5,6-tetradeuterio-4-(trideuteriomethyl)benzene
ZBTMRBYMKUEVEU-AAYPNNLASA-N
[2H]C1=C(C(=C(C(=C1C([2H])([2H])[2H])[2H])[2H])Br)[2H]
4-Bromotoluene-d7 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.